[2-(iodomethyl)-6-methoxy-oxan-3-yl] benzoate structure
|
Common Name | [2-(iodomethyl)-6-methoxy-oxan-3-yl] benzoate | ||
|---|---|---|---|---|
| CAS Number | 21317-48-6 | Molecular Weight | 376.18700 | |
| Density | 1.56g/cm3 | Boiling Point | 421.2ºC at 760 mmHg | |
| Molecular Formula | C14H17IO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 208.5ºC | |
| Name | [2-(iodomethyl)-6-methoxyoxan-3-yl] benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.56g/cm3 |
|---|---|
| Boiling Point | 421.2ºC at 760 mmHg |
| Molecular Formula | C14H17IO4 |
| Molecular Weight | 376.18700 |
| Flash Point | 208.5ºC |
| Exact Mass | 376.01700 |
| PSA | 44.76000 |
| LogP | 2.79850 |
| Vapour Pressure | 2.65E-07mmHg at 25°C |
| Index of Refraction | 1.58 |
| InChIKey | CLMYZZZCONXZSG-UHFFFAOYSA-N |
| SMILES | COC1CCC(OC(=O)c2ccccc2)C(CI)O1 |
|
~%
[2-(iodomethyl)... CAS#:21317-48-6 |
| Literature: Fuerstner, Alois; Jumbam, Denis; Teslic, Judith; Weidmann, Hans Journal of Organic Chemistry, 1991 , vol. 56, # 6 p. 2213 - 2217 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2-(iodomethyl)-6-methoxytetrahydro-2h-pyran-3-yl benzoate |