4-ALLYL-5-BENZYL-4H-1,2,4-TRIAZOLE-3-THIOL structure
|
Common Name | 4-ALLYL-5-BENZYL-4H-1,2,4-TRIAZOLE-3-THIOL | ||
|---|---|---|---|---|
| CAS Number | 21358-12-3 | Molecular Weight | 231.31700 | |
| Density | 1.17g/cm3 | Boiling Point | 331.3ºC at 760 mmHg | |
| Molecular Formula | C12H13N3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 154.2ºC | |
| Name | 3-benzyl-4-prop-2-enyl-1H-1,2,4-triazole-5-thione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.17g/cm3 |
|---|---|
| Boiling Point | 331.3ºC at 760 mmHg |
| Molecular Formula | C12H13N3S |
| Molecular Weight | 231.31700 |
| Flash Point | 154.2ºC |
| Exact Mass | 231.08300 |
| PSA | 69.51000 |
| LogP | 2.34360 |
| Vapour Pressure | 0.000157mmHg at 25°C |
| Index of Refraction | 1.629 |
| InChIKey | IFFJEOWRCIYOCQ-UHFFFAOYSA-N |
| SMILES | C=CCn1c(Cc2ccccc2)n[nH]c1=S |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-Allyl-5-benzyl-1,2,4-triazolinthion-3 |
| 5-benzyl-4-(prop-2-en-1-yl)-4H-1,2,4-triazole-3-thiol |
| 5-benzyl-4-allyl-1,2,4-triazole-3-thione |
| 4-allyl-5-benzyl-4H-1,2,4-triazole-3-thiol |
| 4-allyl-5-benzyl-2,4-dihydro-[1,2,4]triazole-3-thione |