4-CHLORO-2-FLUORO-5-(PYRIMIDIN-2-YLOXY)ANILINE
4-CHLORO-2-FLUORO-5-(PYRIMIDIN-2-YLOXY)ANILINE structure
|
Common Name | 4-CHLORO-2-FLUORO-5-(PYRIMIDIN-2-YLOXY)ANILINE | ||
|---|---|---|---|---|
| CAS Number | 213675-94-6 | Molecular Weight | 239.63300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H7ClFN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 4-Chloro-2-fluoro-5-(pyrimidin-2-yloxy)aniline (CAS number: 213675-94-6), molecular formula: C10H7ClFN3O, molecular weight: 239.63300, For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-chloro-2-fluoro-5-pyrimidin-2-yloxyaniline |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H7ClFN3O |
|---|---|
| Molecular Weight | 239.63300 |
| Exact Mass | 239.02600 |
| PSA | 61.03000 |
| LogP | 3.22480 |
| InChIKey | KQXSKQIBNOCQGQ-UHFFFAOYSA-N |
| SMILES | Nc1cc(Oc2ncccn2)c(Cl)cc1F |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
4-CHLORO-2-FLUO... CAS#:213675-94-6 |
| Literature: US6121201 A1, ; |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-chloro-2-fluoro-5-(2-pyrimidinyloxy)aniline |
| 4-Chloro-2-fluoro-5-(pyrimidin-2-yloxy)aniline |
| 4-Chloro-2-fluoro-5-(2-pyrimidinyloxy)-benzenamine |
| chlorofluoropyrimidinyloxyaniline |
| 2-(5-amino-2-chloro-4-fluorophenoxy)pyrimidine |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 4-chloro-2-fluoro-5-pyrimidin-2-yloxyaniline? |
| A: Molecular weight of 4-chloro-2-fluoro-5-pyrimidin-2-yloxyaniline is 239.63300. |
| Q: What is the polar surface area (PSA) of 4-chloro-2-fluoro-5-pyrimidin-2-yloxyaniline? |
| A: Polar surface area (PSA) of 4-chloro-2-fluoro-5-pyrimidin-2-yloxyaniline is 61.03000. |
| Q: What is the Chinese name of 213675-94-6? |
| A: Chinese name of 213675-94-6 is 213675-94-6. |
| Q: What is the InChIKey of 4-chloro-2-fluoro-5-pyrimidin-2-yloxyaniline? |
| A: InChIKey of 4-chloro-2-fluoro-5-pyrimidin-2-yloxyaniline is KQXSKQIBNOCQGQ-UHFFFAOYSA-N. |
| Q: What is the English name of 4-chloro-2-fluoro-5-pyrimidin-2-yloxyaniline? |
| A: The English name of 4-chloro-2-fluoro-5-pyrimidin-2-yloxyaniline is 4-chloro-2-fluoro-5-pyrimidin-2-yloxyaniline. |
| Q: What is the CAS number of 4-chloro-2-fluoro-5-pyrimidin-2-yloxyaniline? |
| A: CAS number of 4-chloro-2-fluoro-5-pyrimidin-2-yloxyaniline is 213675-94-6. |
| Q: What is the molecular formula of 4-chloro-2-fluoro-5-pyrimidin-2-yloxyaniline? |
| A: Molecular formula of 4-chloro-2-fluoro-5-pyrimidin-2-yloxyaniline is C10H7ClFN3O. |
| Q: What is the LogP of 4-chloro-2-fluoro-5-pyrimidin-2-yloxyaniline? |
| A: LogP of 4-chloro-2-fluoro-5-pyrimidin-2-yloxyaniline is 3.22480. |
| Q: What is the SMILES notation of 4-chloro-2-fluoro-5-pyrimidin-2-yloxyaniline? |
| A: SMILES notation of 4-chloro-2-fluoro-5-pyrimidin-2-yloxyaniline is Nc1cc(Oc2ncccn2)c(Cl)cc1F. |
| Q: What are the upstream materials of 4-chloro-2-fluoro-5-pyrimidin-2-yloxyaniline? |
| A: Related upstream materials(CAS) of 4-chloro-2-fluoro-5-pyrimidin-2-yloxyaniline: 1722-12-9;84478-72-8. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |