hecogenone
hecogenone structure
|
Common Name | hecogenone | ||
|---|---|---|---|---|
| CAS Number | 2137-20-4 | Molecular Weight | 428.60400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H40O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: hecogenone (CAS: 2137-20-4), molecular formula C27H40O4, molecular weight 428.60400, for research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | hecogenone |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C27H40O4 |
|---|---|
| Molecular Weight | 428.60400 |
| Exact Mass | 428.29300 |
| PSA | 52.60000 |
| LogP | 5.18100 |
| InChIKey | GQJDMLOYAFRRDZ-ZSZANOKASA-N |
| SMILES | CC1CCC2(OC1)OC1CC3C4CCC5CC(=O)CCC5(C)C4CC(=O)C3(C)C1C2C |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:467-55-0This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Hecogenon |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of hecogenone? |
| A: SMILES notation of hecogenone is CC1CCC2(OC1)OC1CC3C4CCC5CC(=O)CCC5(C)C4CC(=O)C3(C)C1C2C. |
| Q: What is the Chinese name of 2137-20-4? |
| A: Chinese name of 2137-20-4 is 2137-20-4. |
| Q: What is the InChIKey of hecogenone? |
| A: InChIKey of hecogenone is GQJDMLOYAFRRDZ-ZSZANOKASA-N. |
| Q: What is the molecular weight of hecogenone? |
| A: Molecular weight of hecogenone is 428.60400. |
| Q: What is the CAS number of hecogenone? |
| A: CAS number of hecogenone is 2137-20-4. |
| Q: What is the molecular formula of hecogenone? |
| A: Molecular formula of hecogenone is C27H40O4. |
| Q: What is the English name of hecogenone? |
| A: The English name of hecogenone is hecogenone. |
| Q: What is the LogP of hecogenone? |
| A: LogP of hecogenone is 5.18100. |
| Q: What are the downstream products of hecogenone? |
| A: Related downstream products(CAS) of hecogenone: 467-55-0. |
| Q: What is the polar surface area (PSA) of hecogenone? |
| A: Polar surface area (PSA) of hecogenone is 52.60000. |