5-Chloro-6,7-dimethyl-2-(3-methylbutyl)-[1,2,4]triazolo[1,5-a]pyridine
Modify Date: 2026-08-09 12:12:13
![5-Chloro-6,7-dimethyl-2-(3-methylbutyl)-[1,2,4]triazolo[1,5-a]pyridine Structure](https://www.chemsrc.com/extcaspic/146/2137666-60-3.png)
5-Chloro-6,7-dimethyl-2-(3-methylbutyl)-[1,2,4]triazolo[1,5-a]pyridine structure
|
Common Name | 5-Chloro-6,7-dimethyl-2-(3-methylbutyl)-[1,2,4]triazolo[1,5-a]pyridine | ||
|---|---|---|---|---|
| CAS Number | 2137666-60-3 | Molecular Weight | 251.75 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H18ClN3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-Chloro-6,7-dimethyl-2-(3-methylbutyl)-[1,2,4]triazolo[1,5-a]pyridine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H18ClN3 |
|---|---|
| Molecular Weight | 251.75 |
| InChIKey | ZPLRVPVCRKEABR-UHFFFAOYSA-N |
| SMILES | Cc1cc2nc(CCC(C)C)nn2c(Cl)c1C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2137666-60-3? |
| A: Chinese name of 2137666-60-3 is 2137666-60-3. |
| Q: What is the molecular formula of 5-Chloro-6,7-dimethyl-2-(3-methylbutyl)-[1,2,4]triazolo[1,5-a]pyridine? |
| A: Molecular formula of 5-Chloro-6,7-dimethyl-2-(3-methylbutyl)-[1,2,4]triazolo[1,5-a]pyridine is C13H18ClN3. |
| Q: What is the SMILES notation of 5-Chloro-6,7-dimethyl-2-(3-methylbutyl)-[1,2,4]triazolo[1,5-a]pyridine? |
| A: SMILES notation of 5-Chloro-6,7-dimethyl-2-(3-methylbutyl)-[1,2,4]triazolo[1,5-a]pyridine is Cc1cc2nc(CCC(C)C)nn2c(Cl)c1C. |
| Q: What is the CAS number of 5-Chloro-6,7-dimethyl-2-(3-methylbutyl)-[1,2,4]triazolo[1,5-a]pyridine? |
| A: CAS number of 5-Chloro-6,7-dimethyl-2-(3-methylbutyl)-[1,2,4]triazolo[1,5-a]pyridine is 2137666-60-3. |
| Q: What is the English name of 5-Chloro-6,7-dimethyl-2-(3-methylbutyl)-[1,2,4]triazolo[1,5-a]pyridine? |
| A: The English name of 5-Chloro-6,7-dimethyl-2-(3-methylbutyl)-[1,2,4]triazolo[1,5-a]pyridine is 5-Chloro-6,7-dimethyl-2-(3-methylbutyl)-[1,2,4]triazolo[1,5-a]pyridine. |
| Q: What is the InChIKey of 5-Chloro-6,7-dimethyl-2-(3-methylbutyl)-[1,2,4]triazolo[1,5-a]pyridine? |
| A: InChIKey of 5-Chloro-6,7-dimethyl-2-(3-methylbutyl)-[1,2,4]triazolo[1,5-a]pyridine is ZPLRVPVCRKEABR-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 5-Chloro-6,7-dimethyl-2-(3-methylbutyl)-[1,2,4]triazolo[1,5-a]pyridine? |
| A: Molecular weight of 5-Chloro-6,7-dimethyl-2-(3-methylbutyl)-[1,2,4]triazolo[1,5-a]pyridine is 251.75. |