3-(dimethylamino)-1-(4-nitrophenyl)propan-1-one structure
|
Common Name | 3-(dimethylamino)-1-(4-nitrophenyl)propan-1-one | ||
|---|---|---|---|---|
| CAS Number | 2138-40-1 | Molecular Weight | 222.24000 | |
| Density | 1.172g/cm3 | Boiling Point | 343.2ºC at 760mmHg | |
| Molecular Formula | C11H14N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 161.4ºC | |
| Name | 3-(dimethylamino)-1-(4-nitrophenyl)propan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.172g/cm3 |
|---|---|
| Boiling Point | 343.2ºC at 760mmHg |
| Molecular Formula | C11H14N2O3 |
| Molecular Weight | 222.24000 |
| Flash Point | 161.4ºC |
| Exact Mass | 222.10000 |
| PSA | 66.13000 |
| LogP | 2.25240 |
| Vapour Pressure | 1.69E-05mmHg at 25°C |
| Index of Refraction | 1.573 |
| InChIKey | SJPJHLBDGCNLAL-UHFFFAOYSA-N |
| SMILES | CN(C)CCC(=O)c1ccc([N+](=O)[O-])cc1 |
| HS Code | 2922399090 |
|---|
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 3-dimethylamino-4-nitropropiophenone |
| 3-Dimethylamino-4'-nitropropiophenon |