2-(Perfluorohexyl)-1-ethanol 1,1',1''-triester with boric acid (H3BO3)
Modify Date: 2025-09-21 13:30:13
2-(Perfluorohexyl)-1-ethanol 1,1',1''-triester with boric acid (H3BO3) structure
|
Common Name | 2-(Perfluorohexyl)-1-ethanol 1,1',1''-triester with boric acid (H3BO3) | ||
|---|---|---|---|---|
| CAS Number | 213974-85-7 | Molecular Weight | 1100.1 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H12BF39O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(Perfluorohexyl)-1-ethanol 1,1',1''-triester with boric acid (H3BO3) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C24H12BF39O3 |
|---|---|
| Molecular Weight | 1100.1 |
| InChIKey | OLNZYRAJMGESGX-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCOB(OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 2-(Perfluorohexyl)-1-ethanol 1,1',1''-triester with boric acid (H3BO3)? |
| A: Molecular formula of 2-(Perfluorohexyl)-1-ethanol 1,1',1''-triester with boric acid (H3BO3) is C24H12BF39O3. |
| Q: What is the CAS number of 2-(Perfluorohexyl)-1-ethanol 1,1',1''-triester with boric acid (H3BO3)? |
| A: CAS number of 2-(Perfluorohexyl)-1-ethanol 1,1',1''-triester with boric acid (H3BO3) is 213974-85-7. |
| Q: What is the English name of 2-(Perfluorohexyl)-1-ethanol 1,1',1''-triester with boric acid (H3BO3)? |
| A: The English name of 2-(Perfluorohexyl)-1-ethanol 1,1',1''-triester with boric acid (H3BO3) is 2-(Perfluorohexyl)-1-ethanol 1,1',1''-triester with boric acid (H3BO3). |
| Q: What is the molecular weight of 2-(Perfluorohexyl)-1-ethanol 1,1',1''-triester with boric acid (H3BO3)? |
| A: Molecular weight of 2-(Perfluorohexyl)-1-ethanol 1,1',1''-triester with boric acid (H3BO3) is 1100.1. |
| Q: What is the InChIKey of 2-(Perfluorohexyl)-1-ethanol 1,1',1''-triester with boric acid (H3BO3)? |
| A: InChIKey of 2-(Perfluorohexyl)-1-ethanol 1,1',1''-triester with boric acid (H3BO3) is OLNZYRAJMGESGX-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 2-(Perfluorohexyl)-1-ethanol 1,1',1''-triester with boric acid (H3BO3)? |
| A: SMILES notation of 2-(Perfluorohexyl)-1-ethanol 1,1',1''-triester with boric acid (H3BO3) is FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCOB(OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F. |
| Q: What is the Chinese name of 213974-85-7? |
| A: Chinese name of 213974-85-7 is 213974-85-7. |