2,6,10,14-tetramethylpentadec-2-ene
2,6,10,14-tetramethylpentadec-2-ene structure
|
Common Name | 2,6,10,14-tetramethylpentadec-2-ene | ||
|---|---|---|---|---|
| CAS Number | 2140-83-2 | Molecular Weight | 266.50500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H38 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,6,10,14-tetramethylpentadec-2-ene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C19H38 |
|---|---|
| Molecular Weight | 266.50500 |
| Exact Mass | 266.29700 |
| LogP | 7.00160 |
| InChIKey | YJDOTLRMRJYGGN-UHFFFAOYSA-N |
| SMILES | CC(C)=CCCC(C)CCCC(C)CCCC(C)C |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 8 | |
|---|---|
| DownStream 1 | |
CAS#:111831-51-7
CAS#:55816-07-4
CAS#:111015-66-8
CAS#:59965-20-7
CAS#:111831-48-2
CAS#:111831-53-9
CAS#:111852-41-6
CAS#:111831-50-6
CAS#:502-69-2This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2,6,10,14-tetramethyl-2-pentadecene |
| 2,6,10,14-tetramethyl-pentadec-2-ene |
| 2-Pentadecene,2,6,10,14-tetramethyl |
| phyt-2-ene |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does 2,6,10,14-tetramethylpentadec-2-ene have? |
| A: English synonyms of 2,6,10,14-tetramethylpentadec-2-ene: 2,6,10,14-tetramethyl-2-pentadecene, 2,6,10,14-tetramethyl-pentadec-2-ene, 2-Pentadecene,2,6,10,14-tetramethyl, phyt-2-ene. |
| Q: What is the SMILES notation of 2,6,10,14-tetramethylpentadec-2-ene? |
| A: SMILES notation of 2,6,10,14-tetramethylpentadec-2-ene is CC(C)=CCCC(C)CCCC(C)CCCC(C)C. |
| Q: What is the LogP of 2,6,10,14-tetramethylpentadec-2-ene? |
| A: LogP of 2,6,10,14-tetramethylpentadec-2-ene is 7.00160. |
| Q: What is the molecular weight of 2,6,10,14-tetramethylpentadec-2-ene? |
| A: Molecular weight of 2,6,10,14-tetramethylpentadec-2-ene is 266.50500. |
| Q: What are the upstream materials of 2,6,10,14-tetramethylpentadec-2-ene? |
| A: Related upstream materials(CAS) of 2,6,10,14-tetramethylpentadec-2-ene: 111831-51-7;55816-07-4;111015-66-8;59965-20-7;111831-48-2;111831-53-9;111852-41-6;111831-50-6. |
| Q: What is the English name of 2,6,10,14-tetramethylpentadec-2-ene? |
| A: The English name of 2,6,10,14-tetramethylpentadec-2-ene is 2,6,10,14-tetramethylpentadec-2-ene. |
| Q: What is the InChIKey of 2,6,10,14-tetramethylpentadec-2-ene? |
| A: InChIKey of 2,6,10,14-tetramethylpentadec-2-ene is YJDOTLRMRJYGGN-UHFFFAOYSA-N. |
| Q: What is the CAS number of 2,6,10,14-tetramethylpentadec-2-ene? |
| A: CAS number of 2,6,10,14-tetramethylpentadec-2-ene is 2140-83-2. |
| Q: What is the Chinese name of 2140-83-2? |
| A: Chinese name of 2140-83-2 is 2140-83-2. |
| Q: What is the molecular formula of 2,6,10,14-tetramethylpentadec-2-ene? |
| A: Molecular formula of 2,6,10,14-tetramethylpentadec-2-ene is C19H38. |