Phytone structure
|
Common Name | Phytone | ||
|---|---|---|---|---|
| CAS Number | 502-69-2 | Molecular Weight | 268.478 | |
| Density | 0.8±0.1 g/cm3 | Boiling Point | 316.8±10.0 °C at 760 mmHg | |
| Molecular Formula | C18H36O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 95.1±12.6 °C | |
Use of PhytoneHexahydrofarnesyl acetone (6,10,14-Trimethyl-2-pentadecanone), a sesquiterpene isolated from Launaea mucronata, is the major constituents of the essential oil. Hexahydrofarnesyl acetone has antibacterial, anti-nociceptive and anti-inflammation activities[1][2]. |
| Name | Perhydrofarnesyl Acetone |
|---|---|
| Synonym | More Synonyms |
| Description | Hexahydrofarnesyl acetone (6,10,14-Trimethyl-2-pentadecanone), a sesquiterpene isolated from Launaea mucronata, is the major constituents of the essential oil. Hexahydrofarnesyl acetone has antibacterial, anti-nociceptive and anti-inflammation activities[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 0.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 316.8±10.0 °C at 760 mmHg |
| Molecular Formula | C18H36O |
| Molecular Weight | 268.478 |
| Flash Point | 95.1±12.6 °C |
| Exact Mass | 268.276611 |
| PSA | 17.07000 |
| LogP | 7.26 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.440 |
| InChIKey | WHWDWIHXSPCOKZ-UHFFFAOYSA-N |
| SMILES | CC(=O)CCCC(C)CCCC(C)CCCC(C)C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2914190090 |
| Precursor 9 | |
|---|---|
| DownStream 8 | |
| HS Code | 2914190090 |
|---|---|
| Summary | 2914190090 other acyclic ketones without other oxygen function。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 6,10,14-Trimethyl-2-pentadecanone |
| 2-Pentadecanone, 6,10,14-trimethyl- |
| 6,10,14-trimethylpentadecan-2-one |
| fitone |