Pentyltriphenylphosphonium bromide structure
|
Common Name | Pentyltriphenylphosphonium bromide | ||
|---|---|---|---|---|
| CAS Number | 21406-61-1 | Molecular Weight | 413.330 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H26BrP | Melting Point | 165-168 °C | |
| MSDS | N/A | Flash Point | N/A | |
| Name | pentyl(triphenyl)phosphanium,bromide |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 165-168 °C |
|---|---|
| Molecular Formula | C23H26BrP |
| Molecular Weight | 413.330 |
| Exact Mass | 412.095551 |
| PSA | 13.59000 |
| LogP | 2.17470 |
| InChIKey | VAUKWMSXUKODHR-UHFFFAOYSA-M |
| SMILES | CCCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Br-] |
| Hazard Codes | Xn: Harmful; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S37/39-S26 |
| HS Code | 2931900090 |
|
~97%
Pentyltriphenyl... CAS#:21406-61-1 |
| Literature: Genard, S.; Patin, H. Bulletin de la Societe Chimique de France, 1991 , # 3 p. 397 - 406 |
| Precursor 2 | |
|---|---|
| DownStream 10 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| CH3(CH2)4PPh3Br |
| MFCD00031630 |
| Pentyl(triphenyl)phosphonium bromide |
| Phosphonium, pentyltriphenyl-, bromide (1:1) |
| Amyltriphenylphosphonium bromide |
| EINECS 244-374-5 |
| n-pentyltriphenylphosphonium bromide |
| pentyl-PPh3 bromide |
| pentyl(triphenyl)phosphanium bromide |
| Ph3P(CH2)4CH3Br |
| Pentyltriphenylphosphonium Bromide |
| Ph3P(n-C5H11)Br |