O-[3-chloro-4-(diethylsulfamoyl)phenyl] O,O-dimethyl phosphorothioate structure
|
Common Name | O-[3-chloro-4-(diethylsulfamoyl)phenyl] O,O-dimethyl phosphorothioate | ||
|---|---|---|---|---|
| CAS Number | 21410-51-5 | Molecular Weight | 387.84000 | |
| Density | 1.359g/cm3 | Boiling Point | 448.7°C at 760 mmHg | |
| Molecular Formula | C12H19ClNO5PS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225.2°C | |
| Name | O-[3-chloro-4-(diethylsulfamoyl)phenyl] O,O-dimethyl phosphorothioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.359g/cm3 |
|---|---|
| Boiling Point | 448.7°C at 760 mmHg |
| Molecular Formula | C12H19ClNO5PS2 |
| Molecular Weight | 387.84000 |
| Flash Point | 225.2°C |
| Exact Mass | 387.01300 |
| PSA | 115.35000 |
| LogP | 4.99800 |
| Index of Refraction | 1.551 |
| InChIKey | BASLHEYUURTCNQ-UHFFFAOYSA-N |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(OP(=S)(OC)OC)cc1Cl |
| Phosphorothioic acid, O-[3-chloro-4-[(diethylamino)sulfonyl]phenyl] O,O-dimethyl ester |
| AI 3-27769 |
| IC |
| O,O-Dimethyl O-(4-(N,N-diethylsulfamoyl)-3-chlorophenyl) phosphorothioate |
| Phosphorothioic acid, O-(3-chloro-4-((diethylamino)sulfonyl)phenyl) O,O-dimethyl ester |
| Phosphorothioic acid, O,O-dimethyl ester, O-ester with 2-chloro-N,N-diethyl-4-hydroxybenzenesulfonamide |