N-(5-oxo-1-phenyl-4H-pyrazol-3-yl)benzamide structure
|
Common Name | N-(5-oxo-1-phenyl-4H-pyrazol-3-yl)benzamide | ||
|---|---|---|---|---|
| CAS Number | 2144-96-9 | Molecular Weight | 279.29300 | |
| Density | 1.27g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C16H13N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(5-oxo-1-phenyl-4H-pyrazol-3-yl)benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.27g/cm3 |
|---|---|
| Molecular Formula | C16H13N3O2 |
| Molecular Weight | 279.29300 |
| Exact Mass | 279.10100 |
| PSA | 61.77000 |
| LogP | 2.05830 |
| Index of Refraction | 1.653 |
| InChIKey | SJWZAQBUFIDJQO-UHFFFAOYSA-N |
| SMILES | O=C(NC1=NN(c2ccccc2)C(=O)C1)c1ccccc1 |
| HS Code | 2933199090 |
|---|
|
~77%
N-(5-oxo-1-phen... CAS#:2144-96-9 |
| Literature: Cusan, Claudia; Spalluto, Giampiero; Prato, Maurizio; Adams, Michael; Bodensieck, Antje; Bauer, Rudolf; Tubaro, Aurelia; Bernardi, Paolo; Da Ros, Tatiana Farmaco, 2005 , vol. 60, # 4 p. 327 - 332 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-benzoylamino-2-phenyl-2,4-dihydro-pyrazol-3-one |
| 1-Phenyl-3-benzamido-5-pyrazolon |
| 1-Phenyl-3-benzamido-pyrazolone-5 |