4-Chloro-6,7-dimethoxy-quinoline-3-carbonitrile structure
|
Common Name | 4-Chloro-6,7-dimethoxy-quinoline-3-carbonitrile | ||
|---|---|---|---|---|
| CAS Number | 214470-55-0 | Molecular Weight | 248.66500 | |
| Density | 1.361g/cm3 | Boiling Point | 404.22ºC at 760 mmHg | |
| Molecular Formula | C12H9ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198.266ºC | |
| Name | 4-chloro-6,7-dimethoxyquinoline-3-carbonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.361g/cm3 |
|---|---|
| Boiling Point | 404.22ºC at 760 mmHg |
| Molecular Formula | C12H9ClN2O2 |
| Molecular Weight | 248.66500 |
| Flash Point | 198.266ºC |
| Exact Mass | 248.03500 |
| PSA | 55.14000 |
| LogP | 2.77708 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.621 |
| InChIKey | HMLOMVBFQJAMCN-UHFFFAOYSA-N |
| SMILES | COc1cc2ncc(C#N)c(Cl)c2cc1OC |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933499090 |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-chloro-3-cyano-6,7-dimethoxyquinoline |
| 4-chloro-6,7-dimethoxy-quinoline-3-carbonitrile |
| 3-cyano-4-chloro-6,7-dimethoxyquinoline |
| 4-chloro-6,7-dimethoxy-3-quinolinecarbonitrile |
| 3-Quinolinecarbonitrile,4-chloro-6,7-dimethoxy |