4-[(tert-butoxycarbonylamino)methyl]-2-cyanopyridine structure
|
Common Name | 4-[(tert-butoxycarbonylamino)methyl]-2-cyanopyridine | ||
|---|---|---|---|---|
| CAS Number | 214472-06-7 | Molecular Weight | 233.26600 | |
| Density | 1.15g/cm3 | Boiling Point | 417.3ºC at 760 mmHg | |
| Molecular Formula | C12H15N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 206.2ºC | |
| Name | tert-butyl N-[(2-cyanopyridin-4-yl)methyl]carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.15g/cm3 |
|---|---|
| Boiling Point | 417.3ºC at 760 mmHg |
| Molecular Formula | C12H15N3O2 |
| Molecular Weight | 233.26600 |
| Flash Point | 206.2ºC |
| Exact Mass | 233.11600 |
| PSA | 78.50000 |
| LogP | 2.18238 |
| Vapour Pressure | 3.57E-07mmHg at 25°C |
| Index of Refraction | 1.527 |
| InChIKey | RVMVGHFPBFHBTD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCc1ccnc(C#N)c1 |
| Risk Phrases | 20/21/22-36/37/38 |
|---|---|
| Safety Phrases | 26-36/37/39 |
| HS Code | 2933399090 |
|
~51%
4-[(tert-butoxy... CAS#:214472-06-7 |
| Literature: Yang, Qifei; Olmsted, Courtney; Borhan, Babak Organic Letters, 2002 , vol. 4, # 20 p. 3423 - 3426 |
|
~%
4-[(tert-butoxy... CAS#:214472-06-7 |
| Literature: Organic Letters, , vol. 4, # 20 p. 3423 - 3426 |
|
~%
4-[(tert-butoxy... CAS#:214472-06-7 |
| Literature: Organic Letters, , vol. 4, # 20 p. 3423 - 3426 |
|
~%
4-[(tert-butoxy... CAS#:214472-06-7 |
| Literature: Organic Letters, , vol. 4, # 20 p. 3423 - 3426 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Pyridine-4-N-Boc-aminomethyl-2-nitrile |
| 4-[(tert-Butoxycarbonylamino)methyl]-2-cyanopyridine |
| (2-cyano-pyridin-4-ylmethyl)-carbamic acid tert-butyl ester |
| 4-(Boc-aminomethyl)-2-cyanopyridine |
| 2-Cyano-4-[(tert-butoxycarbonylamino)methyl]pyridine |