11-epi-morgroside V
Modify Date: 2025-08-26 16:33:55
11-epi-morgroside V structure
|
Common Name | 11-epi-morgroside V | ||
|---|---|---|---|---|
| CAS Number | 2146088-12-0 | Molecular Weight | 1287.43 | |
| Density | 1.51±0.1 g/cm3(Predicted) | Boiling Point | N/A | |
| Molecular Formula | C60H102O29 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 11-epi-morgroside V11-epi-mogroside V is a mogroside in the fruit of Siraitia grosvenori. 11-epi-mogroside V exhibits considerable bioactivity in promoting glucose uptake in human HepG2 cells in vitro [1]. |
| Name | 11-epi-mogroside V |
|---|
| Description | 11-epi-mogroside V is a mogroside in the fruit of Siraitia grosvenori. 11-epi-mogroside V exhibits considerable bioactivity in promoting glucose uptake in human HepG2 cells in vitro [1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.51±0.1 g/cm3(Predicted) |
|---|---|
| Molecular Formula | C60H102O29 |
| Molecular Weight | 1287.43 |
| InChIKey | GZWOEHKZNJLOLI-YKFKSEOQSA-N |
| SMILES | CC(CCC(OC1OC(OCC2OC(CO)C(O)C(O)C2O)C(O)C(O)C1OC1OC(CO)C(O)C(O)C1O)C(C)(C)O)C1CCC2(C)C3CC=C4C(CCC(OC5OC(COC6OC(CO)C(O)C(O)C6O)C(O)C(O)C5O)C4(C)C)C3(C)CCC12C |