2-Naphthylmagnesium bromide structure
|
Common Name | 2-Naphthylmagnesium bromide | ||
|---|---|---|---|---|
| CAS Number | 21473-01-8 | Molecular Weight | 231.37200 | |
| Density | 0.951 g/mL at 25 °C | Boiling Point | 65 °C | |
| Molecular Formula | C10H7BrMg | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 1 °F | |
| Name | 2-Naphthylmagnesium bromide |
|---|---|
| Synonym | More Synonyms |
| Density | 0.951 g/mL at 25 °C |
|---|---|
| Boiling Point | 65 °C |
| Molecular Formula | C10H7BrMg |
| Molecular Weight | 231.37200 |
| Flash Point | 1 °F |
| Exact Mass | 229.95800 |
| LogP | 3.48560 |
| Appearance of Characters | Liquid | Clear brown |
| Vapour Pressure | 0.159mmHg at 25°C |
| InChIKey | YLVLCBHNULZXLQ-UHFFFAOYSA-M |
| SMILES | [Br-].[Mg+2].[c-]1ccc2ccccc2c1 |
| Storage condition | 2-8°C |
| Hazard Codes | F,C,F+ |
|---|---|
| Risk Phrases | 11-14-19-34-12 |
| Safety Phrases | 16-26-36/37/39-45 |
| RIDADR | UN 2924 3/PG 2 |
| WGK Germany | 1 |
| HS Code | 2931900090 |
|
~%
2-Naphthylmagne... CAS#:21473-01-8 |
| Literature: Journal of Organic Chemistry, , vol. 57, # 2 p. 636 - 641 |
|
~%
2-Naphthylmagne... CAS#:21473-01-8 |
| Literature: US2007/37983 A1, ; Page/Page column 15 ; |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| MFCD01319910 |
| magnesium,2H-naphthalen-2-ide,bromide |