magnesium,phenoxybenzene,bromide structure
|
Common Name | magnesium,phenoxybenzene,bromide | ||
|---|---|---|---|---|
| CAS Number | 21473-02-9 | Molecular Weight | 273.40800 | |
| Density | 0.968 g/mL at 25 °C | Boiling Point | 65 °C | |
| Molecular Formula | C12H9BrMgO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | <1 °F | |
| Name | magnesium,phenoxybenzene,bromide |
|---|---|
| Synonym | More Synonyms |
| Density | 0.968 g/mL at 25 °C |
|---|---|
| Boiling Point | 65 °C |
| Molecular Formula | C12H9BrMgO |
| Molecular Weight | 273.40800 |
| Flash Point | <1 °F |
| Exact Mass | 271.96900 |
| PSA | 9.23000 |
| LogP | 4.12470 |
| Appearance of Characters | Solution | Clear light yellow |
| InChIKey | MPMNUCMJDPWNCV-UHFFFAOYSA-M |
| SMILES | [Br-].[Mg+2].[c-]1ccc(Oc2ccccc2)cc1 |
| Storage condition | 2-8°C |
| Water Solubility | It reacts with water. |
| Hazard Codes | F: Flammable;C: Corrosive; |
|---|---|
| Risk Phrases | 11-19-22-34 |
| Safety Phrases | 16-23-26-36/37/39-45 |
| RIDADR | UN 2924 3/PG 2 |
| WGK Germany | 1 |
| HS Code | 2931900090 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| 4-Phenoxyphenylmagnesium bromide 0.5 M in Tetrahydrofuran |
| (p-phenoxyphenyl)magnesium bromide |
| RW1224 |
| MFCD00672009 |
| 4-Phenoxyphenylmagnesium bromide |
| 4-PhOC6 H4MgBr |
| 4-Phenoxyphenylmagnesium bromide solution |