Phe-Lys(Fmoc)-PAB structure
|
Common Name | Phe-Lys(Fmoc)-PAB | ||
|---|---|---|---|---|
| CAS Number | 2149584-03-0 | Molecular Weight | 620.74 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C37H40N4O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Phe-Lys(Fmoc)-PABPhe-Lys(Fmoc)-PAB is a cathepsin cleavable ADC linker used for the antibody-drug conjugates (ADCs)[1]. |
| Name | Phe-Lys(Fmoc)-PAB |
|---|
| Description | Phe-Lys(Fmoc)-PAB is a cathepsin cleavable ADC linker used for the antibody-drug conjugates (ADCs)[1]. |
|---|---|
| Related Catalog | |
| Target |
Cleavable |
| References |
| Molecular Formula | C37H40N4O5 |
|---|---|
| Molecular Weight | 620.74 |
| InChIKey | RCPHMUPZDFKBDS-HEVIKAOCSA-N |
| SMILES | NC(Cc1ccccc1)C(=O)NC(CCCCNC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)Nc1ccc(CO)cc1 |
| Storage condition | -20°C |