Phe-Lys(Trt)-PAB structure
|
Common Name | Phe-Lys(Trt)-PAB | ||
|---|---|---|---|---|
| CAS Number | 1116085-99-4 | Molecular Weight | 640.81 | |
| Density | 1.195±0.06 g/cm3(Predicted) | Boiling Point | 880.5±65.0 °C(Predicted) | |
| Molecular Formula | C41H44N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Phe-Lys(Trt)-PABPhe-Lys(Trt)-PAB is a cathepsin cleavable ADC linker used for the antibody-drug conjugates (ADCs)[1]. |
| Name | Phe-Lys(Trt)-PAB |
|---|
| Description | Phe-Lys(Trt)-PAB is a cathepsin cleavable ADC linker used for the antibody-drug conjugates (ADCs)[1]. |
|---|---|
| Related Catalog | |
| Target |
Cleavable |
| References |
| Density | 1.195±0.06 g/cm3(Predicted) |
|---|---|
| Boiling Point | 880.5±65.0 °C(Predicted) |
| Molecular Formula | C41H44N4O3 |
| Molecular Weight | 640.81 |
| InChIKey | SWCZCKQSLIJFDP-UWXQCODUSA-N |
| SMILES | NC(=O)C(CCCCNC(c1ccccc1)(c1ccccc1)c1ccccc1)N(C(=O)C(N)Cc1ccccc1)c1ccc(CO)cc1 |