3-Cyano-PROXYL structure
|
Common Name | 3-Cyano-PROXYL | ||
|---|---|---|---|---|
| CAS Number | 2154-70-3 | Molecular Weight | 167.22800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H15N2O | Melting Point | 31-33ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 235.4 °F | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 1-λ1-oxidanyl-2,2,5,5-tetramethylpyrrolidine-3-carbonitrile |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 31-33ºC(lit.) |
|---|---|
| Molecular Formula | C9H15N2O |
| Molecular Weight | 167.22800 |
| Exact Mass | 167.11800 |
| PSA | 27.03000 |
| LogP | 1.67248 |
| Vapour Pressure | 0.00131mmHg at 25°C |
| Index of Refraction | 1.506 |
| InChIKey | RQRRZZIMMXPAGX-UHFFFAOYSA-N |
| SMILES | CC1(C)CC(C#N)C(C)(C)N1[O] |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302 + H312 + H332 |
| Precautionary Statements | P280 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | 20/21/22 |
| Safety Phrases | 36 |
| RIDADR | NONH for all modes of transport |
| Flash Point(F) | 235.4 °F |
| Flash Point(C) | 113 °C |
|
Identification of nitroxide radioprotectors.
Radiat. Res. 132 , 87, (1992) The nitroxide Tempol, a stable free radical, has recently been shown to protect mammalian cells against several forms of oxidative stress including radiation-induced cytotoxicity. To extend this obser... |
| 3-Cyano-2,2,5,5-tetramethyl-1-pyrrolidinyloxy,free radical |
| 3-Cyano-2,2,5,5-tetramethyl-1-pyrrolidinyl-N-oxyl |
| 1-Pyrrolidinyloxy,3-cyano-2,2,5,5-tetramethyl |
| 2,2,5,5-Tetramethyl-3-cyano-pyrrolidin-1-oxyl |
| MFCD00010548 |
| 3-Cyano-proxyl |
| 3-Cyan-2,2,5,5-tetramethyl-pyrrolidin-1-yloxy |
| 3-cyano-2,2,5,5-tetramethylpyrrolidine-1-oxyl |