Phosphinic amide,P,P-diphenyl-N-(triphenylphosphoranylidene)- structure
|
Common Name | Phosphinic amide,P,P-diphenyl-N-(triphenylphosphoranylidene)- | ||
|---|---|---|---|---|
| CAS Number | 2156-69-6 | Molecular Weight | 477.47300 | |
| Density | 1.14g/cm3 | Boiling Point | 625.3ºC at 760 mmHg | |
| Molecular Formula | C30H25NOP2 | Melting Point | 170-174ºC | |
| MSDS | N/A | Flash Point | 332ºC | |
| Name | (diphenylphosphonimido)triphenylphosphorane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.14g/cm3 |
|---|---|
| Boiling Point | 625.3ºC at 760 mmHg |
| Melting Point | 170-174ºC |
| Molecular Formula | C30H25NOP2 |
| Molecular Weight | 477.47300 |
| Flash Point | 332ºC |
| Exact Mass | 477.14100 |
| PSA | 49.05000 |
| LogP | 6.09320 |
| Vapour Pressure | 7.08E-15mmHg at 25°C |
| Index of Refraction | 1.618 |
| InChIKey | BXXYQIADDPAMGV-UHFFFAOYSA-N |
| SMILES | O=P(N=P(c1ccccc1)(c1ccccc1)c1ccccc1)(c1ccccc1)c1ccccc1 |
| Safety Phrases | S22-S24/25 |
|---|---|
| HS Code | 2931900090 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| N-diphenylphosphoryl-P-triphenylmonophosphazene |
| diphenylphosphinyl-triphenylphosphazene |
| diphenylphosphonimido-triphenylphosphorane |
| (Diphenylphosphonimido)triphenylphosphorane |
| N-<Diphenyl-phosphinyl>-P,P,P-triphenyl-iminophosphoran |