hexaethyl diorthosilicate structure
|
Common Name | hexaethyl diorthosilicate | ||
|---|---|---|---|---|
| CAS Number | 2157-42-8 | Molecular Weight | 342.53300 | |
| Density | 0.999g/cm3 | Boiling Point | 273.9ºC at 760 mmHg | |
| Molecular Formula | C12H30O7Si2 | Melting Point | 16ºC | |
| MSDS | N/A | Flash Point | 105.1ºC | |
| Name | triethyl triethoxysilyl silicate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.999g/cm3 |
|---|---|
| Boiling Point | 273.9ºC at 760 mmHg |
| Melting Point | 16ºC |
| Molecular Formula | C12H30O7Si2 |
| Molecular Weight | 342.53300 |
| Flash Point | 105.1ºC |
| Exact Mass | 342.15300 |
| PSA | 64.61000 |
| LogP | 2.09320 |
| Vapour Pressure | 0.00935mmHg at 25°C |
| Index of Refraction | 1.423 |
| InChIKey | GYTROFMCUJZKNA-UHFFFAOYSA-N |
| SMILES | CCO[Si](OCC)(OCC)O[Si](OCC)(OCC)OCC |
| HS Code | 2920909090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 4 | |
| HS Code | 2920909090 |
|---|---|
| Summary | 2920909090 esters of other inorganic acids of non-metals (excluding esters of hydrogen halides) and their salts; their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| disilicic acid hexaethyl ester |
| Hexaaethoxy-disiloxan |
| Hexaethoxydisiloxane |
| Hexaethyl diorthosilicate |
| Silicic acid,hexaethyl ester |
| Hexaaethyl-disilicat |
| Bis-triaethoxysilyl-aether |
| Dikieselsaeure-hexaaethylester |
| Silicic acid (H6Si2O7),hexaethyl ester |
| EINECS 218-469-7 |