3-(2-Ethoxycarbonylethyl)-2,4-dimethyl-5-formylpyrrole structure
|
Common Name | 3-(2-Ethoxycarbonylethyl)-2,4-dimethyl-5-formylpyrrole | ||
|---|---|---|---|---|
| CAS Number | 21603-70-3 | Molecular Weight | 223.26800 | |
| Density | 1.128g/cm3 | Boiling Point | 351.8ºC at 760mmHg | |
| Molecular Formula | C12H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 166.6ºC | |
| Name | ethyl 3-(5-formyl-2,4-dimethyl-1H-pyrrol-3-yl)propanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.128g/cm3 |
|---|---|
| Boiling Point | 351.8ºC at 760mmHg |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.26800 |
| Flash Point | 166.6ºC |
| Exact Mass | 223.12100 |
| PSA | 59.16000 |
| LogP | 1.93970 |
| Vapour Pressure | 3.99E-05mmHg at 25°C |
| Index of Refraction | 1.542 |
| InChIKey | NECQDWYVPWLBTM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCc1c(C)[nH]c(C=O)c1C |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| OR8264 |
| 5-Formyl-3-<2-ethoxycarbonyl-ethyl>-2,4-dimethyl-pyrrol |