7-chloro-2,8-dimethylquinolin-4-ol structure
|
Common Name | 7-chloro-2,8-dimethylquinolin-4-ol | ||
|---|---|---|---|---|
| CAS Number | 21629-48-1 | Molecular Weight | 207.656 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 329.5±42.0 °C at 760 mmHg | |
| Molecular Formula | C11H10ClNO | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 153.1±27.9 °C | |
| Symbol |
GHS05, GHS06 |
Signal Word | Danger | |
| Name | 7-chloro-2,8-dimethyl-1H-quinolin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 329.5±42.0 °C at 760 mmHg |
| Molecular Formula | C11H10ClNO |
| Molecular Weight | 207.656 |
| Flash Point | 153.1±27.9 °C |
| Exact Mass | 207.045090 |
| PSA | 33.12000 |
| LogP | 4.58 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.579 |
| InChIKey | LOJPYUFGOCWEHF-UHFFFAOYSA-N |
| SMILES | Cc1cc(=O)c2ccc(Cl)c(C)c2[nH]1 |
| Symbol |
GHS05, GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H318 |
| Precautionary Statements | P280-P301 + P310-P305 + P351 + P338 |
| Hazard Codes | Xi: Irritant; |
| RIDADR | UN 2811 6.1 / PGIII |
| HS Code | 2933499090 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4(1H)-Quinolinone, 7-chloro-2,8-dimethyl- |
| 7-chloro-2,8-dimethylquinolin-4-ol |
| 7-Chloro-2,8-dimethyl-4(1H)-quinolinone |
| 4-quinolinol, 7-chloro-2,8-dimethyl- |
| 7-Chloro-2,8-dimethyl-4-quinolinol |
| 7-Chloro-2,8-dimethyl-4-hydroxyquinoline |