Fluometuron structure
|
Common Name | Fluometuron | ||
|---|---|---|---|---|
| CAS Number | 2164-17-2 | Molecular Weight | 232.202 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 323.7±42.0 °C at 760 mmHg | |
| Molecular Formula | C10H11F3N2O | Melting Point | 163°C | |
| MSDS | Chinese USA | Flash Point | 149.6±27.9 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | fluometuron |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 323.7±42.0 °C at 760 mmHg |
| Melting Point | 163°C |
| Molecular Formula | C10H11F3N2O |
| Molecular Weight | 232.202 |
| Flash Point | 149.6±27.9 °C |
| Exact Mass | 232.082352 |
| PSA | 32.34000 |
| LogP | 2.36 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.511 |
| InChIKey | RZILCCPWPBTYDO-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)Nc1cccc(C(F)(F)F)c1 |
| Water Solubility | Slightly soluble. |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302 |
| Precautionary Statements | P301 + P312 + P330 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | R22 |
| RIDADR | NONH for all modes of transport |
| RTECS | YT1575000 |
| HS Code | 3808931100 |
| Precursor 10 | |
|---|---|
| DownStream 3 | |
| HS Code | 2924299032 |
|---|---|
| Summary | 2924299032 1,1-dimethyl-3-(3-(trifluoromethyl)phenyl)urea。supervision conditions:s(import or export registration certificate for pesticides)。VAT:17.0%。tax rebate rate:9.0%。MFN tarrif:6.5%。general tariff:30.0% |
|
Electrically driven microseparation methods for pesticides and metabolites. II: on-line and off-line preconcentration of urea herbicides in capillary electrochromatography.
Electrophoresis 20(12) , 2337-42, (1999) Capillary electrochromatography (CEC) was introduced to the separation of nine important urea herbicides using octadecyl-silica (ODS) capillary columns that were specially designed to allow the realiz... |
|
|
Fluorescent Pseudomonas isolates from Mississippi Delta oxbow lakes: in vitro herbicide biotransformations.
Environ. Toxicol. 16(1) , 9-19, (2001) Fluorescent pseudomonads were a major component [log (10) 4.2-6.1 colony-forming units mL-1] of the culturable heterotrophic gram-negative bacterioplankton observed in three Mississippi Delta oxbow la... |
|
|
Influence of watershed system management on herbicide concentrations in Mississippi Delta oxbow lakes.
Sci. Total Environ. 370(2-3) , 552-60, (2006) The Mississippi Delta Management Systems Evaluation Area (MD-MSEA) project was established in 1994 in three small watersheds (202 to 1,497 ha) that drain into oxbow lakes (Beasley, Deep Hollow, and Th... |
| MFCD00018012 |
| N,N-dimethyl-N’-[3-(trifluoromethyl)phenyl]urea |
| 1,1-Dimethyl-3-[3-(trifluoromethyl)phenyl]urea,Fluomethuron |
| Fluomethuron |
| EINECS 218-500-4 |
| 1,1-dimethyl-3-(3-trifluoromethylphenyl)urea |
| 1,1-Dimethyl-3-(3-(trifluoromethyl)phenyl)urea |
| 1,1-Dimethyl-3-[3-(trifluoromethyl)phenyl]urea |
| Fluometuron |
| Lanex |
| Cotogard |
| Pakhtaran |
| 1,1-Dimethyl-3-(α,α,α-trifluoro-m-tolyl) urea |
| Cottonex |
| Higalcoton |
| Urea, N,N-dimethyl-N'-[3-(trifluoromethyl)phenyl]- |
| 1,1-Dimethyl-3-(α,α,α-trifluoro-m-tolyl)urea |
| Cotoran |