(S)-N-((3-(3-fluoro-4-Morpholinophenyl)-2-oxooxazolidin-5-yl)Methyl)ethanethioamide structure
|
Common Name | (S)-N-((3-(3-fluoro-4-Morpholinophenyl)-2-oxooxazolidin-5-yl)Methyl)ethanethioamide | ||
|---|---|---|---|---|
| CAS Number | 216868-57-4 | Molecular Weight | 353.41200 | |
| Density | 1.324±0.06 g/cm3(Predicted) | Boiling Point | 524.1±60.0℃(Predicted) | |
| Molecular Formula | C16H20FN3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-({(5S)-3-[3-Fluoro-4-(4-morpholinyl)phenyl]-2-oxo-1,3-oxazolidi n-5-yl}methyl)ethanethioamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.324±0.06 g/cm3(Predicted) |
|---|---|
| Boiling Point | 524.1±60.0℃(Predicted) |
| Molecular Formula | C16H20FN3O3S |
| Molecular Weight | 353.41200 |
| Exact Mass | 353.12100 |
| PSA | 93.17000 |
| LogP | 2.46570 |
| InChIKey | ARKKSPJWSZIEQK-ZDUSSCGKSA-N |
| SMILES | CC(=S)NCC1CN(c2ccc(N3CCOCC3)c(F)c2)C(=O)O1 |
| Storage condition | 2-8℃ |
| HS Code | 2934999090 |
|---|
|
~%
(S)-N-((3-(3-fl... CAS#:216868-57-4 |
| Literature: Pharmacia and Upjohn Company Patent: US6342513 B1, 2002 ; Location in patent: Page column 30-31 ; |
|
~%
(S)-N-((3-(3-fl... CAS#:216868-57-4 |
| Literature: Pharmacia and Upjohn Company Patent: US6342513 B1, 2002 ; Location in patent: Page column 34 ; |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Linezolid Impurity 9 |