Ethyl (Z)-3-(4-Chlorophenyl)-2-cyanoacrylate structure
|
Common Name | Ethyl (Z)-3-(4-Chlorophenyl)-2-cyanoacrylate | ||
|---|---|---|---|---|
| CAS Number | 2169-68-8 | Molecular Weight | 235.66600 | |
| Density | 1.249g/cm3 | Boiling Point | 367.9ºC at 760mmHg | |
| Molecular Formula | C12H10ClNO2 | Melting Point | 88-90ºC | |
| MSDS | N/A | Flash Point | 176.3ºC | |
| Name | Ethyl 3-(4-chlorophenyl)-2-cyanoacrylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.249g/cm3 |
|---|---|
| Boiling Point | 367.9ºC at 760mmHg |
| Melting Point | 88-90ºC |
| Molecular Formula | C12H10ClNO2 |
| Molecular Weight | 235.66600 |
| Flash Point | 176.3ºC |
| Exact Mass | 235.04000 |
| PSA | 50.09000 |
| LogP | 2.81008 |
| Vapour Pressure | 1.32E-05mmHg at 25°C |
| Index of Refraction | 1.576 |
| InChIKey | KLUDCHZOLVGLQF-JXMROGBWSA-N |
| SMILES | CCOC(=O)C(C#N)=Cc1ccc(Cl)cc1 |
|
~99%
Ethyl (Z)-3-(4-... CAS#:2169-68-8 |
| Literature: Oskooie, Hossein A.; Roomizadeh, Elham; Heravi, Majid M. Journal of Chemical Research, 2006 , # 4 p. 246 - 247 |
|
~89%
Ethyl (Z)-3-(4-... CAS#:2169-68-8 |
| Literature: Shen, Yanchang; Yang, Baozhen Synthetic Communications, 1989 , vol. 19, # 17 p. 3069 - 3076 |
|
~%
Ethyl (Z)-3-(4-... CAS#:2169-68-8 |
| Literature: Chemische Berichte, , vol. 110, p. 86 - 95 |
| (E)-2-cyano-3-(4-chlorophenyl)-2-propenoic acid ethyl ester |
| RARECHEM AK ML 0352 |
| ethyl 3-(4-chlorophenyl)-2-cyano-prop-2-enoate |
| ethyl (E)-3-(4-chlorophenyl)-2-cyano-2-propenoate |
| ethyl (E)-2-cyano-3-(4-chlorophenyl)-2-acrylate |
| (2E)-3-(4-chlorophenyl)-2-cyano-2-propenoic acid ethyl ester |
| BUTTPARK 486-50 |
| Ethyl (Z)-3-(4-Chlorophenyl)-2-cyanoacrylate |
| ethyl(E)-2-cyano-3-(4-chlorophenyl)-2-propenoate |
| ethyl (2E)-3-(4-chlorophenyl)-2-cyano-2-propenoate |
| 3-(4-chlorophenyl)-2-cyano-acrylic acid ethyl ester |