(4-Chlorophenyl)(triethoxy)silane structure
|
Common Name | (4-Chlorophenyl)(triethoxy)silane | ||
|---|---|---|---|---|
| CAS Number | 21700-74-3 | Molecular Weight | 274.816 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 272.5±23.0 °C at 760 mmHg | |
| Molecular Formula | C12H19ClO3Si | Melting Point | <0ºC | |
| MSDS | N/A | Flash Point | 99.4±14.7 °C | |
| Name | chlorophenyltriethoxysilane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 272.5±23.0 °C at 760 mmHg |
| Melting Point | <0ºC |
| Molecular Formula | C12H19ClO3Si |
| Molecular Weight | 274.816 |
| Flash Point | 99.4±14.7 °C |
| Exact Mass | 274.079193 |
| PSA | 27.69000 |
| LogP | 3.59 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.489 |
| InChIKey | AFILDYMJSTXBAR-UHFFFAOYSA-N |
| SMILES | CCO[Si](OCC)(OCC)c1ccc(Cl)cc1 |
| Risk Phrases | 36/37/38 |
|---|---|
| Safety Phrases | 26-36/37/39 |
| WGK Germany | 3 |
| HS Code | 2931900090 |
|
~34%
(4-Chlorophenyl... CAS#:21700-74-3 |
| Literature: Tetrahedron, , vol. 69, # 16 p. 3465 - 3474 |
|
~74%
(4-Chlorophenyl... CAS#:21700-74-3 |
| Literature: Journal of Organic Chemistry, , vol. 66, # 22 p. 7449 - 7455 |
|
~71%
(4-Chlorophenyl... CAS#:21700-74-3 |
| Literature: Tetrahedron, , vol. 63, # 19 p. 4087 - 4094 |
|
~%
(4-Chlorophenyl... CAS#:21700-74-3 |
| Literature: Heterocycles, , vol. 86, # 2 p. 1055 - 1069 |
|
~%
(4-Chlorophenyl... CAS#:21700-74-3 |
| Literature: Synthesis, , # 15 p. 2231 - 2233 |
| Precursor 7 | |
|---|---|
| DownStream 10 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Silane, (4-chlorophenyl)triethoxy- |
| p-chlorophenyltrimethoxysilane |
| 1-CHLORO-4-TRIETHOXYSILYLBENZENE |
| EINECS 244-533-9 |
| MFCD00053217 |
| Benzene, 1-chloro-4-(triethoxysilyl)- |
| (4-Chlorophenyl)(triethoxy)silane |