1-(3 4-dichlorophenyl)biguanide hydroc& structure
|
Common Name | 1-(3 4-dichlorophenyl)biguanide hydroc& | ||
|---|---|---|---|---|
| CAS Number | 21703-08-2 | Molecular Weight | 282.55800 | |
| Density | N/A | Boiling Point | 470.9ºC at 760 mmHg | |
| Molecular Formula | C8H10Cl3N5 | Melting Point | 222-228ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 238.6ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 1-(diaminomethylidene)-2-(3,4-dichlorophenyl)guanidine,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 470.9ºC at 760 mmHg |
|---|---|
| Melting Point | 222-228ºC(lit.) |
| Molecular Formula | C8H10Cl3N5 |
| Molecular Weight | 282.55800 |
| Flash Point | 238.6ºC |
| Exact Mass | 281.00000 |
| PSA | 97.78000 |
| LogP | 3.98880 |
| Vapour Pressure | 4.89E-09mmHg at 25°C |
| InChIKey | AMMSXYWPWHREDJ-UHFFFAOYSA-N |
| SMILES | Cl.NC(N)=NC(N)=Nc1ccc(Cl)c(Cl)c1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2925290090 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 3,4-Dichlorophenylbiguanide hydrochloride |
| MFCD00173791 |
| 1-(diaminomethylidene)-2-(3,4-dichlorophenyl)guanidine Hydrochloride |
| 1-(3,4-Dichlor-phenyl)-biguanid,Hydrochlorid |
| N-(3,4-dichlorophenyl)imididicarbonimidic diamide hydrochloride |
| 1-(3,4-dichloro-phenyl)-biguanide,hydrochloride |