Arg-Gly-Asp-Cys TFA
Modify Date: 2025-08-26 08:42:50
Arg-Gly-Asp-Cys TFA structure
|
Common Name | Arg-Gly-Asp-Cys TFA | ||
|---|---|---|---|---|
| CAS Number | 2171504-22-4 | Molecular Weight | 563.51 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H28F3N7O9S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Arg-Gly-Asp-Cys TFAArg-Gly-Asp-Cys TFA is the binding motif of fibronectin to cell adhesion molecules. Arg-Gly-Asp-Cys TFA can inhibit platelet aggregation and fibrinogen binding[1]. |
| Name | Arg-Gly-Asp-Cys TFA |
|---|
| Description | Arg-Gly-Asp-Cys TFA is the binding motif of fibronectin to cell adhesion molecules. Arg-Gly-Asp-Cys TFA can inhibit platelet aggregation and fibrinogen binding[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Arg-Gly-Asp-Cys-functionalized chitosan (0.25-1 mg/mL; 2-7 days) favors cell growth and an increase in cellular proliferation compared to the control cells (viability >140%)[1]. Arg-Gly-Asp-Cys-functionalizes chitosan derivatives exhibit in vitro wound healing properties by enhancing fibroblast proliferation and adhesion[1]. |
| References |
| Molecular Formula | C17H28F3N7O9S |
|---|---|
| Molecular Weight | 563.51 |
| InChIKey | AJFGGKXZCJCXNM-YWUTZLAHSA-N |
| SMILES | NC(N)=NCCCC(N)C(=O)NCC(=O)NC(CC(=O)O)C(=O)NC(CS)C(=O)O.O=C(O)C(F)(F)F |