2-{[3-chloro-4-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)phenyl]formamido}-2-cyclopropylacetic acid structure
|
Common Name | 2-{[3-chloro-4-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)phenyl]formamido}-2-cyclopropylacetic acid | ||
|---|---|---|---|---|
| CAS Number | 2171663-20-8 | Molecular Weight | 490.9 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H23ClN2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-{[3-chloro-4-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)phenyl]formamido}-2-cyclopropylacetic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C27H23ClN2O5 |
|---|---|
| Molecular Weight | 490.9 |
| InChIKey | WWCRVAQOMPDNFM-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccc(C(=O)NC(C(=O)O)C2CC2)cc1Cl)OCC1c2ccccc2-c2ccccc21 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2171663-20-8? |
| A: Chinese name of 2171663-20-8 is 2171663-20-8. |
| Q: What is the English name of 2-{[3-chloro-4-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)phenyl]formamido}-2-cyclopropylacetic acid? |
| A: The English name of 2-{[3-chloro-4-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)phenyl]formamido}-2-cyclopropylacetic acid is 2-{[3-chloro-4-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)phenyl]formamido}-2-cyclopropylacetic acid. |
| Q: What is the molecular formula of 2-{[3-chloro-4-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)phenyl]formamido}-2-cyclopropylacetic acid? |
| A: Molecular formula of 2-{[3-chloro-4-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)phenyl]formamido}-2-cyclopropylacetic acid is C27H23ClN2O5. |
| Q: What is the CAS number of 2-{[3-chloro-4-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)phenyl]formamido}-2-cyclopropylacetic acid? |
| A: CAS number of 2-{[3-chloro-4-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)phenyl]formamido}-2-cyclopropylacetic acid is 2171663-20-8. |
| Q: What is the SMILES notation of 2-{[3-chloro-4-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)phenyl]formamido}-2-cyclopropylacetic acid? |
| A: SMILES notation of 2-{[3-chloro-4-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)phenyl]formamido}-2-cyclopropylacetic acid is O=C(Nc1ccc(C(=O)NC(C(=O)O)C2CC2)cc1Cl)OCC1c2ccccc2-c2ccccc21. |
| Q: What is the InChIKey of 2-{[3-chloro-4-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)phenyl]formamido}-2-cyclopropylacetic acid? |
| A: InChIKey of 2-{[3-chloro-4-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)phenyl]formamido}-2-cyclopropylacetic acid is WWCRVAQOMPDNFM-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 2-{[3-chloro-4-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)phenyl]formamido}-2-cyclopropylacetic acid? |
| A: Molecular weight of 2-{[3-chloro-4-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)phenyl]formamido}-2-cyclopropylacetic acid is 490.9. |