3,3,3-tris(p-chlorophenyl)propionyl chloride structure
|
Common Name | 3,3,3-tris(p-chlorophenyl)propionyl chloride | ||
|---|---|---|---|---|
| CAS Number | 2172-49-8 | Molecular Weight | 424.14700 | |
| Density | 1.367g/cm3 | Boiling Point | 522.1ºC at 760 mmHg | |
| Molecular Formula | C21H14Cl4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 217.9ºC | |
| Name | 3,3,3-tris(4-chlorophenyl)propanoyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.367g/cm3 |
|---|---|
| Boiling Point | 522.1ºC at 760 mmHg |
| Molecular Formula | C21H14Cl4O |
| Molecular Weight | 424.14700 |
| Flash Point | 217.9ºC |
| Exact Mass | 421.98000 |
| PSA | 17.07000 |
| LogP | 7.13670 |
| Vapour Pressure | 5.32E-11mmHg at 25°C |
| Index of Refraction | 1.615 |
| InChIKey | FPBMIAQHNZESKZ-UHFFFAOYSA-N |
| SMILES | O=C(Cl)CC(c1ccc(Cl)cc1)(c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| HS Code | 2916399090 |
|---|
|
~89%
3,3,3-tris(p-ch... CAS#:2172-49-8 |
| Literature: Hannam, Jeffrey S.; Kidd, Timothy J.; Leigh, David A.; Wilson, Andrew J. Organic Letters, 2003 , vol. 5, # 11 p. 1907 - 1910 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| einecs 218-525-0 |