3,3,3-tris(4-chlorophenyl)propanoic acid structure
|
Common Name | 3,3,3-tris(4-chlorophenyl)propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 2168-06-1 | Molecular Weight | 405.702 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 505.8±45.0 °C at 760 mmHg | |
| Molecular Formula | C21H15Cl3O2 | Melting Point | 190-193 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 259.7±28.7 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 3,3,3-tris(4-chlorophenyl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 505.8±45.0 °C at 760 mmHg |
| Melting Point | 190-193 °C(lit.) |
| Molecular Formula | C21H15Cl3O2 |
| Molecular Weight | 405.702 |
| Flash Point | 259.7±28.7 °C |
| Exact Mass | 404.013763 |
| PSA | 37.30000 |
| LogP | 6.86 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.627 |
| InChIKey | LHIVWYJOCNGZRI-UHFFFAOYSA-N |
| SMILES | O=C(O)CC(c1ccc(Cl)cc1)(c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2916399090 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Aurintricarboxylic acid blocks in vitro and in vivo activity of YopH, an essential virulent factor of Yersinia pestis, the agent of plague.
J. Biol. Chem. 278(43) , 41734-41, (2003) Yersinia are causative agents in human diseases ranging from gastrointestinal syndromes to Bubonic Plague. There is increasing risk of misuse of infectious agents, such as Yersinia pestis, as weapons ... |
| 3,3,3-tris(4-chlorophenyl)propanoic acid |
| 3,3,3-tris(p-chlorophenyl)propionic acid |
| EINECS 218-509-3 |
| 3,3,3-Tris(4-chlorophenyl) propionic acid |
| MFCD00010264 |
| Benzenepropanoic acid, 4-chloro-β,β-bis(4-chlorophenyl)- |