5-(2-methoxyphenyl)methylenehydantoin structure
|
Common Name | 5-(2-methoxyphenyl)methylenehydantoin | ||
|---|---|---|---|---|
| CAS Number | 21730-69-8 | Molecular Weight | 218.20900 | |
| Density | 1.317g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H10N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-[(2-methoxyphenyl)methylidene]imidazolidine-2,4-dione |
|---|
| Density | 1.317g/cm3 |
|---|---|
| Molecular Formula | C11H10N2O3 |
| Molecular Weight | 218.20900 |
| Exact Mass | 218.06900 |
| PSA | 74.41000 |
| LogP | 0.79140 |
| Index of Refraction | 1.619 |
| InChIKey | YOFKIDCKEYKPNO-SOFGYWHQSA-N |
| SMILES | COc1ccccc1C=C1NC(=O)NC1=O |
| HS Code | 2933990090 |
|---|
|
~%
5-(2-methoxyphe... CAS#:21730-69-8 |
| Literature: Johnson; Scott Journal of the American Chemical Society, 1915 , vol. 37, p. 1855 |
|
~%
5-(2-methoxyphe... CAS#:21730-69-8 |
| Literature: Canada Packers Limited; The Institute of Microbiology and Hygiene of the University of Montreal Patent: US4013770 A1, 1977 ; |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |