3-(4-isopropylphenyl)-1,1-dimethylurea-d6 structure
|
Common Name | 3-(4-isopropylphenyl)-1,1-dimethylurea-d6 | ||
|---|---|---|---|---|
| CAS Number | 217487-17-7 | Molecular Weight | 212.32100 | |
| Density | 1.081g/cm3 | Boiling Point | 353.2ºC at 760 mmHg | |
| Molecular Formula | C12H12D6N2O | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 167.4ºC | |
| Symbol |
GHS07, GHS08, GHS09 |
Signal Word | Warning | |
| Name | 3-(4-propan-2-ylphenyl)-1,1-bis(trideuteriomethyl)urea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.081g/cm3 |
|---|---|
| Boiling Point | 353.2ºC at 760 mmHg |
| Molecular Formula | C12H12D6N2O |
| Molecular Weight | 212.32100 |
| Flash Point | 167.4ºC |
| Exact Mass | 212.18000 |
| PSA | 32.34000 |
| LogP | 2.97650 |
| Vapour Pressure | 3.64E-05mmHg at 25°C |
| Index of Refraction | 1.555 |
| InChIKey | PUIYMUZLKQOUOZ-LIJFRPJRSA-N |
| SMILES | CC(C)c1ccc(NC(=O)N(C)C)cc1 |
| Symbol |
GHS07, GHS08, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H332-H351-H410 |
| Precautionary Statements | P261-P273-P304 + P340 + P312-P391-P501 |
| Personal Protective Equipment | Eyeshields;Gloves |
| Hazard Codes | Xn: Harmful;N: Dangerous for the environment; |
| Risk Phrases | 40-50/53 |
| Safety Phrases | 36/37-60-61 |
| RIDADR | UN 3077 9/PG 3 |
|
Risk assessment of pesticides detected in surface water of the Alqueva reservoir (Guadiana basin, southern of Portugal).
Sci. Total Environ. 488-489 , 208-19, (2014) The purpose of this study was to evaluate the potential impact of the pesticides detected in the Alqueva reservoir (Guadiana Basin, South Iberian Peninsula) on the aquatic organisms belonging to this ... |
| Isoproturon-d6 |
| 3-(4-Isopropylphenyl)-1,1-dimethylurea-d6 |