(R)-2-((1-PHENYLETHYL)CARBAMOYL)BENZOIC ACID structure
|
Common Name | (R)-2-((1-PHENYLETHYL)CARBAMOYL)BENZOIC ACID | ||
|---|---|---|---|---|
| CAS Number | 21752-35-2 | Molecular Weight | 269.295 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 500.3±43.0 °C at 760 mmHg | |
| Molecular Formula | C16H15NO3 | Melting Point | 128-130ºC | |
| MSDS | Chinese USA | Flash Point | 256.4±28.2 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-[[(1R)-1-phenylethyl]carbamoyl]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 500.3±43.0 °C at 760 mmHg |
| Melting Point | 128-130ºC |
| Molecular Formula | C16H15NO3 |
| Molecular Weight | 269.295 |
| Flash Point | 256.4±28.2 °C |
| Exact Mass | 269.105194 |
| PSA | 66.40000 |
| LogP | 2.42 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.606 |
| InChIKey | VCFKXWGKKDZMPO-LLVKDONJSA-N |
| SMILES | CC(NC(=O)c1ccccc1C(=O)O)c1ccccc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2924299090 |
|
~%
(R)-2-((1-PHENY... CAS#:21752-35-2 |
| Literature: Bulletin de la Societe Chimique de France, , p. 4439 - 4446 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Kozma, D. et al.
J. Therm. Anal. 44 , 339, (1995)
|
|
|
Acs, M. et al.
Chirality 6 , 314, (1994)
|
| (R)-(+)-N-(1-Phenylethyl)phthalamic Acid |
| MFCD00063050 |
| 2-{[(1R)-1-Phenylethyl]carbamoyl}benzoic acid |
| EINECS 244-570-0 |
| (R)-(+)-N-(α-Methylbenzyl)phthalaMic Acid |
| (R)-2-((1-Phenylethyl)carbamoyl)benzoic acid |
| R/S-(+)-N-(1-PHENYLETHYL)PHTHALAMIC ACID |