(S)-(-)-N-(α-Methylbenzyl)phthalamic Acid structure
|
Common Name | (S)-(-)-N-(α-Methylbenzyl)phthalamic Acid | ||
|---|---|---|---|---|
| CAS Number | 21752-36-3 | Molecular Weight | 269.29500 | |
| Density | 1.222 g/cm3 | Boiling Point | 500.3ºC at 760 mmHg | |
| Molecular Formula | C16H15NO3 | Melting Point | 128-130 °C | |
| MSDS | Chinese USA | Flash Point | 256.3ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | (s)-(-)-n-(1-phenylethyl)phthalamic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.222 g/cm3 |
|---|---|
| Boiling Point | 500.3ºC at 760 mmHg |
| Melting Point | 128-130 °C |
| Molecular Formula | C16H15NO3 |
| Molecular Weight | 269.29500 |
| Flash Point | 256.3ºC |
| Exact Mass | 269.10500 |
| PSA | 66.40000 |
| LogP | 3.26670 |
| Vapour Pressure | 7.92E-11mmHg at 25°C |
| Index of Refraction | -46 ° (C=2, EtOH) |
| InChIKey | VCFKXWGKKDZMPO-NSHDSACASA-N |
| SMILES | CC(NC(=O)c1ccccc1C(=O)O)c1ccccc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2924299090 |
|
~78%
(S)-(-)-N-(α-Me... CAS#:21752-36-3 |
| Literature: NEON LABORATORIES LIMITED; DALVI, Mahesh Bhagoji; KENNY, Rajesh Shashikant; TARADE, Pradeep Kisan Patent: WO2014/9964 A1, 2014 ; Location in patent: Page/Page column 17 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| (S)-(-)-N-(1-Phenylethyl)phthalamic Acid |
| (S)-(-)-N-(alpha-Methylbenzyl)phthalaMic Acid |
| forresolutionofracemates |
| (S)-(-)-N-(α-Methylbenzyl)phthalamic Acid |
| 2-[[[(1S)-1-Phenylethyl]Amino]Carbonyl]-Benzoic Acid |
| (S)-2-(1-phenylethylcarbamoyl)benzoic acid |
| N-((S)-1-phenylethyl)phthalamic acid |
| (S)-o-{[(1-phenylethyl)amino]carbonyl}benzoic acid |
| (S)-(1-PHENYLETHYL)PHTHALAMIC ACID |
| Einecs 244-571-6 |
| N-((S)-1-Phenyl-aethyl)-phthalamidsaeure |
| MFCD00013979 |
| (-)-N-(1-PHENYLETHYL)PHTHALIC ACID MONOAMIDE |
| (S)-(-)-N-(A-Methylbenzyl)phthalamidicacid |
| (S)-2-((1-Phenylethyl)carbamoyl)benzoic acid |