9,16-Dioxo-10,12,14-octadecatrienoic acid structure
|
Common Name | 9,16-Dioxo-10,12,14-octadecatrienoic acid | ||
|---|---|---|---|---|
| CAS Number | 217810-46-3 | Molecular Weight | 306.397 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 506.6±35.0 °C at 760 mmHg | |
| Molecular Formula | C18H26O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 274.2±22.4 °C | |
| Name | (10E,12E,14E)-9,16-Dioxo-10,12,14-octadecatrienoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 506.6±35.0 °C at 760 mmHg |
| Molecular Formula | C18H26O4 |
| Molecular Weight | 306.397 |
| Flash Point | 274.2±22.4 °C |
| Exact Mass | 306.183105 |
| PSA | 71.44000 |
| LogP | 2.00 |
| Vapour Pressure | 0.0±2.8 mmHg at 25°C |
| Index of Refraction | 1.502 |
| InChIKey | PQPRTPXWQQQKJC-KDXRDGMUSA-N |
| SMILES | CCC(=O)C=CC=CC=CC(=O)CCCCCCCC(=O)O |
| HS Code | 2918300090 |
|---|
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 10,12,14-Octadecatrienoic acid, 9,16-dioxo-, (10E,12E,14E)- |
| (10E,12E,14E)-9,16-Dioxo-10,12,14-octadecatrienoic acid |