α-Allyloxymethyl-2-nitro-1H-imidazole-1-ethanol structure
|
Common Name | α-Allyloxymethyl-2-nitro-1H-imidazole-1-ethanol | ||
|---|---|---|---|---|
| CAS Number | 21787-89-3 | Molecular Weight | 227.21700 | |
| Density | 1.31g/cm3 | Boiling Point | 446.3ºC at 760 mmHg | |
| Molecular Formula | C9H13N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 223.7ºC | |
| Name | 1-(2-nitroimidazol-1-yl)-3-prop-2-enoxypropan-2-ol |
|---|
| Density | 1.31g/cm3 |
|---|---|
| Boiling Point | 446.3ºC at 760 mmHg |
| Molecular Formula | C9H13N3O4 |
| Molecular Weight | 227.21700 |
| Flash Point | 223.7ºC |
| Exact Mass | 227.09100 |
| PSA | 93.10000 |
| LogP | 0.87800 |
| Vapour Pressure | 9.48E-09mmHg at 25°C |
| Index of Refraction | 1.563 |
| InChIKey | ZGENSUYRNWPOET-UHFFFAOYSA-N |
| SMILES | C=CCOCC(O)Cn1ccnc1[N+](=O)[O-] |
| HS Code | 2933290090 |
|---|
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |