5-Ethyl-2-nitro-1H-imidazole-1-ethanol structure
|
Common Name | 5-Ethyl-2-nitro-1H-imidazole-1-ethanol | ||
|---|---|---|---|---|
| CAS Number | 23571-39-3 | Molecular Weight | 185.18100 | |
| Density | 1.38g/cm3 | Boiling Point | 406.8ºC at 760mmHg | |
| Molecular Formula | C7H11N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 199.8ºC | |
| Name | 2-(5-ethyl-2-nitroimidazol-1-yl)ethanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.38g/cm3 |
|---|---|
| Boiling Point | 406.8ºC at 760mmHg |
| Molecular Formula | C7H11N3O3 |
| Molecular Weight | 185.18100 |
| Flash Point | 199.8ºC |
| Exact Mass | 185.08000 |
| PSA | 83.87000 |
| LogP | 0.86920 |
| Vapour Pressure | 2.4E-07mmHg at 25°C |
| Index of Refraction | 1.595 |
| InChIKey | ABGJIKXMJUSARA-UHFFFAOYSA-N |
| SMILES | CCc1cnc([N+](=O)[O-])n1CCO |
| HS Code | 2933290090 |
|---|
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Imidazole-1-ethanol,5-ethyl-2-nitro |
| 5-Ethyl-2-nitroimidazole-1-ethanol |