(R)-MALT1-IN-7
Modify Date: 2025-08-26 11:20:26
(R)-MALT1-IN-7 structure
|
Common Name | (R)-MALT1-IN-7 | ||
|---|---|---|---|---|
| CAS Number | 2178993-10-5 | Molecular Weight | 478.45 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H17F3N8O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of (R)-MALT1-IN-7(R)-MALT1-IN-7 (compound 142a) is a potent MALT1 protease inhibitor. (R)-MALT1-IN-7 has the potential for cancer research[1]. |
| Name | (R)-MALT1-IN-7 |
|---|
| Description | (R)-MALT1-IN-7 (compound 142a) is a potent MALT1 protease inhibitor. (R)-MALT1-IN-7 has the potential for cancer research[1]. |
|---|---|
| Related Catalog | |
| References |
[1]. Gagan Kukreja, et al. Substituted thiazolo-pyridine compounds as malt1 inhibitors. WO2018020474A1. |
| Molecular Formula | C19H17F3N8O2S |
|---|---|
| Molecular Weight | 478.45 |
| InChIKey | UVUPDKHEDALPJC-SECBINFHSA-N |
| SMILES | COC(C)c1c(NC(=O)Nc2cnc(-n3nccn3)c(C(F)(F)F)c2)cnc2sc(C)nc12 |