Potassium 2,5-dihydroxybenzenesulfonate structure
|
Common Name | Potassium 2,5-dihydroxybenzenesulfonate | ||
|---|---|---|---|---|
| CAS Number | 21799-87-1 | Molecular Weight | 228.264 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H5KO5S | Melting Point | 251 °C (dec.)(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | potassium,2,5-dihydroxybenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 251 °C (dec.)(lit.) |
|---|---|
| Molecular Formula | C6H5KO5S |
| Molecular Weight | 228.264 |
| Exact Mass | 227.949478 |
| PSA | 106.04000 |
| LogP | 1.08270 |
| InChIKey | VKDSBABHIXQFKH-UHFFFAOYSA-M |
| SMILES | O=S(=O)([O-])c1cc(O)ccc1O.[K+] |
| Stability | Stable. Incompatible with bases, oxidizing agents. |
| Water Solubility | soluble |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 2 |
| HS Code | 29082000 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| HS Code | 2908999090 |
|---|---|
| Summary | 2908999090 halogenated, sulphonated, nitrated or nitrosated derivatives of phenols or phenol-alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|
Evaluation of calcium dobesilate for its anti-cataract potential in experimental animal models.
Methods Find. Exp. Clin. Pharmacol. 32(3) , 171-9, (2010) The present study evaluated the protective action of calcium dobesilate (CDO) in various experimental models of cataract. CDO was studied in hydrocortisone-induced cataract in developing chick embryos... |
|
|
Phlebotonics for haemorrhoids.
Cochrane Database Syst. Rev. 8 , CD004322, (2012) Haemorrhoids are variceal dilatations of the anal and perianal venous plexus and often develop secondary to the persistently elevated venous pressure within the haemorrhoidal plexus (Kumar 2005). Phle... |
|
|
Attenuation of streptozotocin-induced diabetic retinopathy with low molecular weight fucoidan via inhibition of vascular endothelial growth factor.
Exp. Eye Res. 115 , 96-105, (2013) Diabetic retinopathy (DR) is a hyperglycemia-induced ischemic disorder characterized by microvascular dysfunction and neovascularization. It is a leading cause of blindness in many countries, yet effi... |
| Hydroquinone sulfonic acid,potassium salt |
| Hydroquinonesulfonate potassium salt |
| hydroquinone-2-sulfonic acid potassium salt |
| Potassium 2,5-dihydroxybenzenesulfonate |
| EINECS 244-584-7 |
| 2,5-Dihydroxybenzenesulfonic Acid Potassium Salt |
| Hydroquinonesulfonic Acid Potassium Salt |
| 2,5-dihydroxybenzene sulfonic acid potassium salt |
| Benzenesulfonic acid,2,5-dihydroxy-,monopotassium salt |
| potassium hydroquinonesulfonate |
| Hydroquinone Sulfonic Acid Potassium Salt |
| potassium hydroguinone sulphonate |
| hydroquinonesulfonic acid,potassium salt |
| MFCD00007475 |
| BENZENESULFONIC ACID, 2,5-DIHYDROXY-, MONOPOTASSIUM SALT |
| Benzenesulfonic acid, 2,5-dihydroxy-, potassium salt (1:1) |