Sulfo-Cyanine3 amine structure
|
Common Name | Sulfo-Cyanine3 amine | ||
|---|---|---|---|---|
| CAS Number | 2183440-43-7 | Molecular Weight | 714.935 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C36H50N4O7S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Sulfo-Cyanine3 amineSulfo-Cy3 amine is a dye derivative of Cyanine 3 (Cy3) (HY-D0822) bearing an amine group. The sulfonate ion increases the water solubility of the compound, making it suitable for use in aqueous solutions. Cy3 is a fluorescent dye with a fluorescence spectrum typically in the green to orange wavelength range. The amine functionality of Sulfo-Cy3 amine can react with carboxyl groups to form covalent bonds. Sulfo-Cy3 amine can bind to biological molecules such as proteins and antibodies to track their location and dynamic changes in biological samples. |
| Name | 1-{6-[(6-Ammoniohexyl)amino]-6-oxohexyl}-3,3-dimethyl-2-[(1E,3E)-3-(1,3,3-trimethyl-5-sulfonato-1,3-dihydro-2H-indol-2-ylidene)-1-propen-1-yl]-3H-indolium-5-sulfonate |
|---|---|
| Synonym | More Synonyms |
| Description | Sulfo-Cy3 amine is a dye derivative of Cyanine 3 (Cy3) (HY-D0822) bearing an amine group. The sulfonate ion increases the water solubility of the compound, making it suitable for use in aqueous solutions. Cy3 is a fluorescent dye with a fluorescence spectrum typically in the green to orange wavelength range. The amine functionality of Sulfo-Cy3 amine can react with carboxyl groups to form covalent bonds. Sulfo-Cy3 amine can bind to biological molecules such as proteins and antibodies to track their location and dynamic changes in biological samples. |
|---|---|
| Related Catalog |
| Molecular Formula | C36H50N4O7S2 |
|---|---|
| Molecular Weight | 714.935 |
| Exact Mass | 714.312073 |
| InChIKey | ZVOZJQQPUBRDRD-UHFFFAOYSA-N |
| SMILES | C[N+]1=C(C=CC=C2N(CCCCCC(=O)NCCCCCC[NH3+])c3ccc(S(=O)(=O)[O-])cc3C2(C)C)C(C)(C)c2cc(S(=O)(=O)[O-])ccc21 |
| 3H-Indolium, 1-[6-[(6-aminohexyl)amino]-6-oxohexyl]-2-[(1E,3E)-3-(1,3-dihydro-1,3,3-trimethyl-5-sulfo-2H-indol-2-ylidene)-1-propen-1-yl]-3,3-dimethyl-5-sulfo-, inner salt |
| 1-{6-[(6-Ammoniohexyl)amino]-6-oxohexyl}-3,3-dimethyl-2-[(1E,3E)-3-(1,3,3-trimethyl-5-sulfonato-1,3-dihydro-2H-indol-2-ylidene)-1-propen-1-yl]-3H-indolium-5-sulfonate |