Cyanine3 amine structure
|
Common Name | Cyanine3 amine | ||
|---|---|---|---|---|
| CAS Number | 2247688-56-6 | Molecular Weight | 627.730 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C36H52Cl2N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Cyanine3 amineCyanine3 amine hydrochloride, an analog of Cyanine3 amine, is a potent green fluorescent dye. Cyanine3 amine hydrochloride has the primary amine group and is covalently coupled with reactive groups such as NHS esters, carboxy groups (after carbodiimide activation), and epoxides. (λex=555 nm, λem=570 nm)[1]. |
| Name | 1-{6-[(6-Ammoniohexyl)amino]-6-oxohexyl}-3,3-dimethyl-2-[(1E,3E)-3-(1,3,3-trimethyl-1,3-dihydro-2H-indol-2-ylidene)-1-propen-1-yl]-3H-indolium dichloride |
|---|---|
| Synonym | More Synonyms |
| Description | Cyanine3 amine hydrochloride, an analog of Cyanine3 amine, is a potent green fluorescent dye. Cyanine3 amine hydrochloride has the primary amine group and is covalently coupled with reactive groups such as NHS esters, carboxy groups (after carbodiimide activation), and epoxides. (λex=555 nm, λem=570 nm)[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C36H52Cl2N4O |
|---|---|
| Molecular Weight | 627.730 |
| Exact Mass | 626.351807 |
| InChIKey | VYQVCEXMTWTAMW-UHFFFAOYSA-N |
| SMILES | C[N+]1=C(C=CC=C2N(CCCCCC(=O)NCCCCCC[NH3+])c3ccccc3C2(C)C)C(C)(C)c2ccccc21.[Cl-].[Cl-] |
| Storage condition | -20°C |
| 3H-Indolium, 1-[6-[(6-ammoniohexyl)amino]-6-oxohexyl]-2-[(1E,3E)-3-(1,3-dihydro-1,3,3-trimethyl-2H-indol-2-ylidene)-1-propen-1-yl]-3,3-dimethyl-, chloride (1:2) |
| 1-{6-[(6-Ammoniohexyl)amino]-6-oxohexyl}-3,3-dimethyl-2-[(1E,3E)-3-(1,3,3-trimethyl-1,3-dihydro-2H-indol-2-ylidene)-1-propen-1-yl]-3H-indolium dichloride |