BDP R6G amine structure
|
Common Name | BDP R6G amine | ||
|---|---|---|---|---|
| CAS Number | 2183473-06-3 | Molecular Weight | 474.782 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H30BClF2N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of BDP R6G amineBDP R6G is a borondipyrromethene dye matching Rhodamine 6G (R6G) channel. This derivative of the fluorophore contains aliphatic amine group in salt form. The amine group can be conjugated with electrophiles. Amines can also used in enzymatic transamination. |
| Name | Difluoro{6-[(3-{5-[(5-phenyl-2H-pyrrol-2-ylidene-κN)methyl]-1H-pyrrol-2-yl-κN}propanoyl)amino]-1-hexanaminiumato}boron(1+) chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C24H30BClF2N4O |
|---|---|
| Molecular Weight | 474.782 |
| Exact Mass | 474.216919 |
| InChIKey | MNYJFICGJSOWBU-UHFFFAOYSA-N |
| SMILES | [Cl-].[NH3+]CCCCCCNC(=O)CCc1ccc2n1[B-](F)(F)[N+]1=C(c3ccccc3)C=CC1=C2 |
| Boron(1+), difluoro[6-[[1-oxo-3-[5-[(5-phenyl-2H-pyrrol-2-ylidene-κN)methyl]-1H-pyrrol-2-yl-κN]propyl]amino]-1-hexanaminiumato]-, chloride (1:1) |
| Difluoro{6-[(3-{5-[(5-phenyl-2H-pyrrol-2-ylidene-κN)methyl]-1H-pyrrol-2-yl-κN}propanoyl)amino]-1-hexanaminiumato}boron(1+) chloride |