Physcion-10,10'-bianthrone structure
|
Common Name | Physcion-10,10'-bianthrone | ||
|---|---|---|---|---|
| CAS Number | 21871-90-9 | Molecular Weight | 538.54400 | |
| Density | 1.443g/cm3 | Boiling Point | 741.7ºC at 760 mmHg | |
| Molecular Formula | C32H26O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 244.5ºC | |
| Name | 10-(4,5-dihydroxy-2-methoxy-7-methyl-10-oxo-9H-anthracen-9-yl)-1,8-dihydroxy-3-methoxy-6-methyl-10H-anthracen-9-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.443g/cm3 |
|---|---|
| Boiling Point | 741.7ºC at 760 mmHg |
| Molecular Formula | C32H26O8 |
| Molecular Weight | 538.54400 |
| Flash Point | 244.5ºC |
| Exact Mass | 538.16300 |
| PSA | 133.52000 |
| LogP | 5.19580 |
| Vapour Pressure | 9.43E-23mmHg at 25°C |
| Index of Refraction | 1.709 |
| InChIKey | CZJNLQOXUCEPOH-UHFFFAOYSA-N |
| SMILES | COc1cc(O)c2c(c1)C(C1c3cc(C)cc(O)c3C(=O)c3c(O)cc(OC)cc31)c1cc(C)cc(O)c1C2=O |
|
~%
Physcion-10,10'... CAS#:21871-90-9 |
| Literature: Kitanaka, Susumu; Takido, Michio Phytochemistry (Elsevier), 1982 , vol. 21, # 8 p. 2103 - 2106 |
| Precursor 1 | |
|---|---|
| DownStream 3 | |
|
Name: Stability of the compound by HPLC analysis
Source: ChEMBL
Target: N/A
External Id: CHEMBL4400209
|
| physcion bianthrone |
| Physcion-9,9'-Dianthron |
| Physcion-10,10'-bianthrone |