N-(1-methylsulfanyl-9H-fluoren-2-yl)acetamide structure
|
Common Name | N-(1-methylsulfanyl-9H-fluoren-2-yl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 21879-09-4 | Molecular Weight | 269.36100 | |
| Density | 1.25g/cm3 | Boiling Point | 480ºC at 760 mmHg | |
| Molecular Formula | C16H15NOS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 244.1ºC | |
| Name | N-(1-methylsulfanyl-9H-fluoren-2-yl)acetamide |
|---|
| Density | 1.25g/cm3 |
|---|---|
| Boiling Point | 480ºC at 760 mmHg |
| Molecular Formula | C16H15NOS |
| Molecular Weight | 269.36100 |
| Flash Point | 244.1ºC |
| Exact Mass | 269.08700 |
| PSA | 57.89000 |
| LogP | 4.58760 |
| Vapour Pressure | 2.25E-09mmHg at 25°C |
| Index of Refraction | 1.667 |
| InChIKey | YTPNIIZUNVNNCV-UHFFFAOYSA-N |
| SMILES | CSc1c(NC(C)=O)ccc2c1Cc1ccccc1-2 |
|
~%
N-(1-methylsulf... CAS#:21879-09-4 |
| Literature: Elfarra; Hanna Journal of Medicinal Chemistry, 1985 , vol. 28, # 10 p. 1453 - 1460 |
|
~%
N-(1-methylsulf... CAS#:21879-09-4 |
| Literature: Elfarra; Hanna Journal of Medicinal Chemistry, 1985 , vol. 28, # 10 p. 1453 - 1460 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |