1H-Indole-3-aceticacid, 2-methyl-, ethyl ester structure
|
Common Name | 1H-Indole-3-aceticacid, 2-methyl-, ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 21909-49-9 | Molecular Weight | 217.26400 | |
| Density | 1.158g/cm3 | Boiling Point | 366.1ºC at 760mmHg | |
| Molecular Formula | C13H15NO2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 175.2ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | ethyl 2-(2-methyl-1H-indol-3-yl)acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.158g/cm3 |
|---|---|
| Boiling Point | 366.1ºC at 760mmHg |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.26400 |
| Flash Point | 175.2ºC |
| Exact Mass | 217.11000 |
| PSA | 42.09000 |
| LogP | 2.58190 |
| Vapour Pressure | 1.5E-05mmHg at 25°C |
| Index of Refraction | n20/D 1.571(lit.) |
| InChIKey | SLEXJGHKKHQSDC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Cc1c(C)[nH]c2ccccc12 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| (2-Methyl-indol-3-yl)-essigsaeure-aethylester |
| 2-methylindole-3-acetic acid |
| 2-methyl-1H-indole-3-acetic acid ethyl ester |
| (2-methyl-1H-indol-3-yl)acetic acid ethyl ester |
| Ethyl 2-methyl-3-indoleacetate |
| MFCD02093647 |
| (2-methyl-indol-3-yl)-acetic acid ethyl ester |
| ethyl (2-methylindol-3-yl)acetate |