5-Chloro-2-methyl-3-nitroaniline structure
|
Common Name | 5-Chloro-2-methyl-3-nitroaniline | ||
|---|---|---|---|---|
| CAS Number | 219312-44-4 | Molecular Weight | 186.596 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 333.4±37.0 °C at 760 mmHg | |
| Molecular Formula | C7H7ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 155.4±26.5 °C | |
| Name | 5-chloro-2-methyl-3-nitroaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 333.4±37.0 °C at 760 mmHg |
| Molecular Formula | C7H7ClN2O2 |
| Molecular Weight | 186.596 |
| Flash Point | 155.4±26.5 °C |
| Exact Mass | 186.019608 |
| PSA | 71.84000 |
| LogP | 2.80 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.628 |
| InChIKey | KBFNZWHWSZUQNI-UHFFFAOYSA-N |
| SMILES | Cc1c(N)cc(Cl)cc1[N+](=O)[O-] |
| Hazard Codes | Xn |
|---|---|
| HS Code | 2921430090 |
|
~59%
5-Chloro-2-meth... CAS#:219312-44-4 |
| Literature: Array Biopharma, Inc. Patent: US2010/63066 A1, 2010 ; Location in patent: Page/Page column 36 ; |
|
~%
5-Chloro-2-meth... CAS#:219312-44-4 |
| Literature: Ruggli; Zaeslin Helvetica Chimica Acta, 1936 , vol. 19, p. 434,437 |
|
~%
5-Chloro-2-meth... CAS#:219312-44-4 |
| Literature: Cohen; Mc Candlish Journal of the Chemical Society, 1905 , vol. 87, p. 1265 |
|
~%
5-Chloro-2-meth... CAS#:219312-44-4 |
| Literature: Cohen; Mc Candlish Journal of the Chemical Society, 1905 , vol. 87, p. 1265 |
| HS Code | 2921430090 |
|---|---|
| Summary | HS:2921430090 toluidines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Benzenamine, 5-chloro-2-methyl-3-nitro- |
| Benzenamine,5-chloro-2-methyl-3-nitro |
| 5-Chlor-3-nitro-o-toluidin |
| 5-Chloro-2-methyl-3-nitroaniline |
| 5-Chlor-2-methyl-3-nitro-anilin |
| 4-Chlor-6-nitro-2-amino-toluol |
| 5-chloro-2-methyl-3-nitro-aniline |
| 2-Amino-4-chloro-6-nitrotoluene |