Phenylalanine,3-carboxy- structure
|
Common Name | Phenylalanine,3-carboxy- | ||
|---|---|---|---|---|
| CAS Number | 2196-56-7 | Molecular Weight | 209.19900 | |
| Density | 1.394g/cm3 | Boiling Point | 445.7ºC at 760 mmHg | |
| Molecular Formula | C10H11NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 223.4ºC | |
| Name | 3-(2-amino-2-carboxyethyl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.394g/cm3 |
|---|---|
| Boiling Point | 445.7ºC at 760 mmHg |
| Molecular Formula | C10H11NO4 |
| Molecular Weight | 209.19900 |
| Flash Point | 223.4ºC |
| Exact Mass | 209.06900 |
| PSA | 100.62000 |
| LogP | 1.03950 |
| Vapour Pressure | 9.98E-09mmHg at 25°C |
| Index of Refraction | 1.616 |
| InChIKey | JANONUPBHGWOBP-UHFFFAOYSA-N |
| SMILES | NC(Cc1cccc(C(=O)O)c1)C(=O)O |
| HS Code | 2922499990 |
|---|
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| 3-Carboxy-phenylalanin |
| 3-carboxy-phenylalanine |